About hydron;thieno[3,2-b]thiophene
hydron;thieno[3,2-b]thiophene (PubChem CID 174437334) has the molecular formula C6H5S2+
and a molecular weight of 141.24 g/mol. Its IUPAC name is hydron;thieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | hydron;thieno[3,2-b]thiophene |
| PubChem CID | 174437334 |
| Molecular Formula | C6H5S2+ |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 140.98 |
| IUPAC Name | hydron;thieno[3,2-b]thiophene |
| SMILES | [H+].c1cc2sccc2s1 |
| InChI | InChI=1S/C6H4S2/c1-3-7-6-2-4-8-5(1)6/h1-4H/p+1 |
| InChIKey | VJYJJHQEVLEOFL-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydron;thieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;thieno[3,2-b]thiophene?
The IUPAC name of hydron;thieno[3,2-b]thiophene (CID 174437334) is hydron;thieno[3,2-b]thiophene.
What is the SMILES notation for hydron;thieno[3,2-b]thiophene?
The canonical SMILES for hydron;thieno[3,2-b]thiophene is [H+].c1cc2sccc2s1.
What is the InChIKey of hydron;thieno[3,2-b]thiophene?
The InChIKey is VJYJJHQEVLEOFL-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4S2/c1-3-7-6-2-4-8-5(1)6/h1-4H/p+1.
What are the key properties of hydron;thieno[3,2-b]thiophene?
hydron;thieno[3,2-b]thiophene has a molecular weight of 141.24 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;thieno[3,2-b]thiophene is sourced from PubChem (CID 174437334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).