C6H6S2Sn — CID 149433263
thieno[3,2-b]thiophen-5-ylstannane (PubChem CID 149433263) has the molecular formula C6H6S2Sn and a molecular weight of 260.96 g/mol. Its IUPAC name is thieno[3,2-b]thiophen-5-ylstannane.
| Compound Name | thieno[3,2-b]thiophen-5-ylstannane |
|---|---|
| PubChem CID | 149433263 |
| Molecular Formula | C6H6S2Sn |
| Molecular Weight | 260.96 g/mol |
| Exact Mass | 261.89 |
| IUPAC Name | thieno[3,2-b]thiophen-5-ylstannane |
| SMILES | [SnH3]c1cc2sccc2s1 |
| InChI | InChI=1S/C6H3S2.Sn.3H/c1-3-7-6-2-4-8-5(1)6;;;;/h1-3H;;;; |
| InChIKey | AXQYXHNHPUMAJT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.96 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |