C8H9NS2 — CID 170868981
2-thieno[3,2-b]thiophen-5-ylethanamine (PubChem CID 170868981) has the molecular formula C8H9NS2 and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-thieno[3,2-b]thiophen-5-ylethanamine.
| Compound Name | 2-thieno[3,2-b]thiophen-5-ylethanamine |
|---|---|
| PubChem CID | 170868981 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-thieno[3,2-b]thiophen-5-ylethanamine |
| SMILES | NCCc1cc2sccc2s1 |
| InChI | InChI=1S/C8H9NS2/c9-3-1-6-5-8-7(11-6)2-4-10-8/h2,4-5H,1,3,9H2 |
| InChIKey | DYHOJCKLKNVUSR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |