About 2-thieno[3,2-b]thiophen-5-ylethanamine
2-thieno[3,2-b]thiophen-5-ylethanamine (PubChem CID 170868981) has the molecular formula C8H9NS2
and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-thieno[3,2-b]thiophen-5-ylethanamine.
Molecular Properties
| Compound Name | 2-thieno[3,2-b]thiophen-5-ylethanamine |
| PubChem CID | 170868981 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-thieno[3,2-b]thiophen-5-ylethanamine |
| SMILES | NCCc1cc2sccc2s1 |
| InChI | InChI=1S/C8H9NS2/c9-3-1-6-5-8-7(11-6)2-4-10-8/h2,4-5H,1,3,9H2 |
| InChIKey | DYHOJCKLKNVUSR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thieno[3,2-b]thiophen-5-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[3,2-b]thiophen-5-ylethanamine?
The IUPAC name of 2-thieno[3,2-b]thiophen-5-ylethanamine (CID 170868981) is 2-thieno[3,2-b]thiophen-5-ylethanamine.
What is the SMILES notation for 2-thieno[3,2-b]thiophen-5-ylethanamine?
The canonical SMILES for 2-thieno[3,2-b]thiophen-5-ylethanamine is NCCc1cc2sccc2s1.
What is the InChIKey of 2-thieno[3,2-b]thiophen-5-ylethanamine?
The InChIKey is DYHOJCKLKNVUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS2/c9-3-1-6-5-8-7(11-6)2-4-10-8/h2,4-5H,1,3,9H2.
What are the key properties of 2-thieno[3,2-b]thiophen-5-ylethanamine?
2-thieno[3,2-b]thiophen-5-ylethanamine has a molecular weight of 183.30 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[3,2-b]thiophen-5-ylethanamine is sourced from PubChem (CID 170868981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).