About N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine
N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine (PubChem CID 80711429) has the molecular formula C12H11NS3
and a molecular weight of 265.43 g/mol. Its IUPAC name is N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine.
Molecular Properties
| Compound Name | N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine |
| PubChem CID | 80711429 |
| Molecular Formula | C12H11NS3 |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine |
| SMILES | c1csc(CNCc2cc3sccc3s2)c1 |
| InChI | InChI=1S/C12H11NS3/c1-2-9(14-4-1)7-13-8-10-6-12-11(16-10)3-5-15-12/h1-6,13H,7-8H2 |
| InChIKey | NOIFHDRAGPEGDE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine?
The IUPAC name of N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine (CID 80711429) is N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine.
What is the SMILES notation for N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine?
The canonical SMILES for N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine is c1csc(CNCc2cc3sccc3s2)c1.
What is the InChIKey of N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine?
The InChIKey is NOIFHDRAGPEGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS3/c1-2-9(14-4-1)7-13-8-10-6-12-11(16-10)3-5-15-12/h1-6,13H,7-8H2.
What are the key properties of N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine?
N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine has a molecular weight of 265.43 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thieno[3,2-b]thiophen-5-ylmethyl)-1-thiophen-2-ylmethanamine is sourced from PubChem (CID 80711429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).