C10H11NS2 — CID 80744766
N-(thieno[3,2-b]thiophen-5-ylmethyl)cyclopropanamine (PubChem CID 80744766) has the molecular formula C10H11NS2 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-(thieno[3,2-b]thiophen-5-ylmethyl)cyclopropanamine.
| Compound Name | N-(thieno[3,2-b]thiophen-5-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 80744766 |
| Molecular Formula | C10H11NS2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | N-(thieno[3,2-b]thiophen-5-ylmethyl)cyclopropanamine |
| SMILES | c1cc2sc(CNC3CC3)cc2s1 |
| InChI | InChI=1S/C10H11NS2/c1-2-7(1)11-6-8-5-10-9(13-8)3-4-12-10/h3-5,7,11H,1-2,6H2 |
| InChIKey | GTEWYMGEOVMOTN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |