C9H11NS2 — CID 170868168
3-thieno[3,2-b]thiophen-5-ylpropan-1-amine (PubChem CID 170868168) has the molecular formula C9H11NS2 and a molecular weight of 197.33 g/mol. Its IUPAC name is 3-thieno[3,2-b]thiophen-5-ylpropan-1-amine.
| Compound Name | 3-thieno[3,2-b]thiophen-5-ylpropan-1-amine |
|---|---|
| PubChem CID | 170868168 |
| Molecular Formula | C9H11NS2 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 3-thieno[3,2-b]thiophen-5-ylpropan-1-amine |
| SMILES | NCCCc1cc2sccc2s1 |
| InChI | InChI=1S/C9H11NS2/c10-4-1-2-7-6-9-8(12-7)3-5-11-9/h3,5-6H,1-2,4,10H2 |
| InChIKey | UZNKFHSNFGIZPX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |