C10H6S4 — CID 14118307
[1,4]dithiino[2,3-g][1,4]benzodithiine (PubChem CID 14118307) has the molecular formula C10H6S4 and a molecular weight of 254.43 g/mol. Its IUPAC name is [1,4]dithiino[2,3-g][1,4]benzodithiine.
| Compound Name | [1,4]dithiino[2,3-g][1,4]benzodithiine |
|---|---|
| PubChem CID | 14118307 |
| Molecular Formula | C10H6S4 |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | [1,4]dithiino[2,3-g][1,4]benzodithiine |
| SMILES | c1csc2cc3sccsc3cc2s1 |
| InChI | InChI=1S/C10H6S4/c1-2-12-8-6-10-9(5-7(8)11-1)13-3-4-14-10/h1-6H |
| InChIKey | IJGLKUFZEXTZAL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|