C9H6N2OS2 — CID 80745588
3-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-5-amine (PubChem CID 80745588) has the molecular formula C9H6N2OS2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-5-amine.
| Compound Name | 3-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 80745588 |
| Molecular Formula | C9H6N2OS2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 3-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cc3sccc3s2)no1 |
| InChI | InChI=1S/C9H6N2OS2/c10-9-3-5(11-12-9)7-4-8-6(14-7)1-2-13-8/h1-4H,10H2 |
| InChIKey | MHEIRDNBRNHIMV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |