C12H12N2OS2 — CID 113490807
4-propan-2-yl-5-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-3-amine (PubChem CID 113490807) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4-propan-2-yl-5-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-3-amine.
| Compound Name | 4-propan-2-yl-5-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 113490807 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-propan-2-yl-5-thieno[3,2-b]thiophen-5-yl-1,2-oxazol-3-amine |
| SMILES | CC(C)c1c(N)noc1-c1cc2sccc2s1 |
| InChI | InChI=1S/C12H12N2OS2/c1-6(2)10-11(15-14-12(10)13)9-5-8-7(17-9)3-4-16-8/h3-6H,1-2H3,(H2,13,14) |
| InChIKey | XOKVCONQRWILJT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |