About 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine
4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine (PubChem CID 136984255) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine |
| PubChem CID | 136984255 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine |
| SMILES | CC(C)c1c(N)noc1-c1cn[nH]c1 |
| InChI | InChI=1S/C9H12N4O/c1-5(2)7-8(14-13-9(7)10)6-3-11-12-4-6/h3-5H,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | OUVWGORFKYBYLW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine?
The IUPAC name of 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine (CID 136984255) is 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine.
What is the SMILES notation for 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine?
The canonical SMILES for 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine is CC(C)c1c(N)noc1-c1cn[nH]c1.
What is the InChIKey of 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine?
The InChIKey is OUVWGORFKYBYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-5(2)7-8(14-13-9(7)10)6-3-11-12-4-6/h3-5H,1-2H3,(H2,10,13)(H,11,12).
What are the key properties of 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine?
4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine has a molecular weight of 192.22 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-5-(1H-pyrazol-4-yl)-1,2-oxazol-3-amine is sourced from PubChem (CID 136984255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).