C8H8N4O — CID 102923030
4-methyl-5-pyrimidin-5-yl-1,2-oxazol-3-amine (PubChem CID 102923030) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 4-methyl-5-pyrimidin-5-yl-1,2-oxazol-3-amine.
| Compound Name | 4-methyl-5-pyrimidin-5-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 102923030 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 4-methyl-5-pyrimidin-5-yl-1,2-oxazol-3-amine |
| SMILES | Cc1c(N)noc1-c1cncnc1 |
| InChI | InChI=1S/C8H8N4O/c1-5-7(13-12-8(5)9)6-2-10-4-11-3-6/h2-4H,1H3,(H2,9,12) |
| InChIKey | ROLQQEIQLCXYHE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |