C9H6S2 — CID 135040771
5-prop-1-ynylthieno[3,2-b]thiophene (PubChem CID 135040771) has the molecular formula C9H6S2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-prop-1-ynylthieno[3,2-b]thiophene.
| Compound Name | 5-prop-1-ynylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 135040771 |
| Molecular Formula | C9H6S2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 5-prop-1-ynylthieno[3,2-b]thiophene |
| SMILES | CC#Cc1cc2sccc2s1 |
| InChI | InChI=1S/C9H6S2/c1-2-3-7-6-9-8(11-7)4-5-10-9/h4-6H,1H3 |
| InChIKey | ZCZIHEFJMRSJMU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|