C11H5NS2 — CID 102479264
thieno[3,2-e][1]benzothiole-2-carbonitrile (PubChem CID 102479264) has the molecular formula C11H5NS2 and a molecular weight of 215.30 g/mol. Its IUPAC name is thieno[3,2-e][1]benzothiole-2-carbonitrile.
| Compound Name | thieno[3,2-e][1]benzothiole-2-carbonitrile |
|---|---|
| PubChem CID | 102479264 |
| Molecular Formula | C11H5NS2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | thieno[3,2-e][1]benzothiole-2-carbonitrile |
| SMILES | N#Cc1cc2c(ccc3sccc32)s1 |
| InChI | InChI=1S/C11H5NS2/c12-6-7-5-9-8-3-4-13-10(8)1-2-11(9)14-7/h1-5H |
| InChIKey | OCRONHQENVNKMX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |