C9H5NO2S — CID 130785844
4,5-dihydroxy-1-benzothiophene-2-carbonitrile (PubChem CID 130785844) has the molecular formula C9H5NO2S and a molecular weight of 191.21 g/mol. Its IUPAC name is 4,5-dihydroxy-1-benzothiophene-2-carbonitrile.
| Compound Name | 4,5-dihydroxy-1-benzothiophene-2-carbonitrile |
|---|---|
| PubChem CID | 130785844 |
| Molecular Formula | C9H5NO2S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.00 |
| IUPAC Name | 4,5-dihydroxy-1-benzothiophene-2-carbonitrile |
| SMILES | N#Cc1cc2c(O)c(O)ccc2s1 |
| InChI | InChI=1S/C9H5NO2S/c10-4-5-3-6-8(13-5)2-1-7(11)9(6)12/h1-3,11-12H |
| InChIKey | TXLKNQWWSXRPET-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|