C8H3IN2S — CID 142031513
4-iodothieno[2,3-c]pyridine-2-carbonitrile (PubChem CID 142031513) has the molecular formula C8H3IN2S and a molecular weight of 286.10 g/mol. Its IUPAC name is 4-iodothieno[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 4-iodothieno[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 142031513 |
| Molecular Formula | C8H3IN2S |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | 4-iodothieno[2,3-c]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc2c(I)cncc2s1 |
| InChI | InChI=1S/C8H3IN2S/c9-7-3-11-4-8-6(7)1-5(2-10)12-8/h1,3-4H |
| InChIKey | QUMVMKZYKYJHJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|