C34H20S4 — CID 101335692
2-[(E)-1,2-diphenyl-2-thieno[3,2-e][1]benzothiol-2-ylethenyl]thieno[3,2-e][1]benzothiole (PubChem CID 101335692) has the molecular formula C34H20S4 and a molecular weight of 556.80 g/mol. Its IUPAC name is 2-[(E)-1,2-diphenyl-2-thieno[3,2-e][1]benzothiol-2-ylethenyl]thieno[3,2-e][1]benzothiole.
| Compound Name | 2-[(E)-1,2-diphenyl-2-thieno[3,2-e][1]benzothiol-2-ylethenyl]thieno[3,2-e][1]benzothiole |
|---|---|
| PubChem CID | 101335692 |
| Molecular Formula | C34H20S4 |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 2-[(E)-1,2-diphenyl-2-thieno[3,2-e][1]benzothiol-2-ylethenyl]thieno[3,2-e][1]benzothiole |
| SMILES | c1ccc(/C(=C(/c2ccccc2)c2cc3c(ccc4sccc43)s2)c2cc3c(ccc4sccc43)s2)cc1 |
| InChI | InChI=1S/C34H20S4/c1-3-7-21(8-4-1)33(31-19-25-23-15-17-35-27(23)11-13-29(25)37-31)34(22-9-5-2-6-10-22)32-20-26-24-16-18-36-28(24)12-14-30(26)38-32/h1-20H/b34-33+ |
| InChIKey | OKQNPKJNQSIPPA-JEIPZWNWSA-N |
| XLogP | 11.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|