C20H12N2S3 — CID 161323465
dibenzothiophene;thieno[3,2-e][1,2,3]benzothiadiazole (PubChem CID 161323465) has the molecular formula C20H12N2S3 and a molecular weight of 376.53 g/mol. Its IUPAC name is dibenzothiophene;thieno[3,2-e][1,2,3]benzothiadiazole.
| Compound Name | dibenzothiophene;thieno[3,2-e][1,2,3]benzothiadiazole |
|---|---|
| PubChem CID | 161323465 |
| Molecular Formula | C20H12N2S3 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | dibenzothiophene;thieno[3,2-e][1,2,3]benzothiadiazole |
| SMILES | c1cc2c(ccc3snnc32)s1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.C8H4N2S2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-7-8(9-10-12-7)5-3-4-11-6(1)5/h1-8H;1-4H |
| InChIKey | VKLMUJFAURYPSD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |