About benzo[e][1]benzothiole;pyrimidine
benzo[e][1]benzothiole;pyrimidine (PubChem CID 175481177) has the molecular formula C16H12N2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is benzo[e][1]benzothiole;pyrimidine.
Molecular Properties
| Compound Name | benzo[e][1]benzothiole;pyrimidine |
| PubChem CID | 175481177 |
| Molecular Formula | C16H12N2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | benzo[e][1]benzothiole;pyrimidine |
| SMILES | c1ccc2c(c1)ccc1sccc12.c1cncnc1 |
| InChI | InChI=1S/C12H8S.C4H4N2/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;1-2-5-4-6-3-1/h1-8H;1-4H |
| InChIKey | IRMWMDHVRYLBAO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[e][1]benzothiole;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1]benzothiole;pyrimidine?
The IUPAC name of benzo[e][1]benzothiole;pyrimidine (CID 175481177) is benzo[e][1]benzothiole;pyrimidine.
What is the SMILES notation for benzo[e][1]benzothiole;pyrimidine?
The canonical SMILES for benzo[e][1]benzothiole;pyrimidine is c1ccc2c(c1)ccc1sccc12.c1cncnc1.
What is the InChIKey of benzo[e][1]benzothiole;pyrimidine?
The InChIKey is IRMWMDHVRYLBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.C4H4N2/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;1-2-5-4-6-3-1/h1-8H;1-4H.
What are the key properties of benzo[e][1]benzothiole;pyrimidine?
benzo[e][1]benzothiole;pyrimidine has a molecular weight of 264.35 g/mol, XLogP of 4.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1]benzothiole;pyrimidine is sourced from PubChem (CID 175481177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).