About 1-benzothiophene
1-benzothiophene (PubChem CID 7221) has the molecular formula C8H6S
and a molecular weight of 134.20 g/mol. Its IUPAC name is 1-benzothiophene.
Molecular Properties
| Compound Name | 1-benzothiophene |
| PubChem CID | 7221 |
| Molecular Formula | C8H6S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 1-benzothiophene |
| SMILES | c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S/c1-2-4-8-7(3-1)5-6-9-8/h1-6H |
| InChIKey | FCEHBMOGCRZNNI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene?
The IUPAC name of 1-benzothiophene (CID 7221) is 1-benzothiophene.
What is the SMILES notation for 1-benzothiophene?
The canonical SMILES for 1-benzothiophene is c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene?
The InChIKey is FCEHBMOGCRZNNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S/c1-2-4-8-7(3-1)5-6-9-8/h1-6H.
What are the key properties of 1-benzothiophene?
1-benzothiophene has a molecular weight of 134.20 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene is sourced from PubChem (CID 7221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).