About 1-benzothiophene;ethane;pentan-2-one
1-benzothiophene;ethane;pentan-2-one (PubChem CID 91163325) has the molecular formula C15H22OS
and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-benzothiophene;ethane;pentan-2-one.
Molecular Properties
| Compound Name | 1-benzothiophene;ethane;pentan-2-one |
| PubChem CID | 91163325 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-benzothiophene;ethane;pentan-2-one |
| SMILES | CC.CCCC(C)=O.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.C5H10O.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-3-4-5(2)6;1-2/h1-6H;3-4H2,1-2H3;1-2H3 |
| InChIKey | HIQSLZILMBXESD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzothiophene;ethane;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;ethane;pentan-2-one?
The IUPAC name of 1-benzothiophene;ethane;pentan-2-one (CID 91163325) is 1-benzothiophene;ethane;pentan-2-one.
What is the SMILES notation for 1-benzothiophene;ethane;pentan-2-one?
The canonical SMILES for 1-benzothiophene;ethane;pentan-2-one is CC.CCCC(C)=O.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;ethane;pentan-2-one?
The InChIKey is HIQSLZILMBXESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C5H10O.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-3-4-5(2)6;1-2/h1-6H;3-4H2,1-2H3;1-2H3.
What are the key properties of 1-benzothiophene;ethane;pentan-2-one?
1-benzothiophene;ethane;pentan-2-one has a molecular weight of 250.41 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;ethane;pentan-2-one is sourced from PubChem (CID 91163325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).