About 1-benzothiophene borate
1-benzothiophene borate (PubChem CID 19601166) has the molecular formula C8H6BO3S-3
and a molecular weight of 193.01 g/mol. Its IUPAC name is 1-benzothiophene borate.
Molecular Properties
| Compound Name | 1-benzothiophene borate |
| PubChem CID | 19601166 |
| Molecular Formula | C8H6BO3S-3 |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 1-benzothiophene borate |
| SMILES | [O-]B([O-])[O-].c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.BO3/c1-2-4-8-7(3-1)5-6-9-8;2-1(3)4/h1-6H;/q;-3 |
| InChIKey | VUJLDSOCUDYILY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene borate?
The IUPAC name of 1-benzothiophene borate (CID 19601166) is 1-benzothiophene borate.
What is the SMILES notation for 1-benzothiophene borate?
The canonical SMILES for 1-benzothiophene borate is [O-]B([O-])[O-].c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene borate?
The InChIKey is VUJLDSOCUDYILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.BO3/c1-2-4-8-7(3-1)5-6-9-8;2-1(3)4/h1-6H;/q;-3.
What are the key properties of 1-benzothiophene borate?
1-benzothiophene borate has a molecular weight of 193.01 g/mol, XLogP of -1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene borate is sourced from PubChem (CID 19601166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).