About 1-benzothiophene;thiophene
1-benzothiophene;thiophene (PubChem CID 67877268) has the molecular formula C12H10S2
and a molecular weight of 218.35 g/mol. Its IUPAC name is 1-benzothiophene;thiophene.
Molecular Properties
| Compound Name | 1-benzothiophene;thiophene |
| PubChem CID | 67877268 |
| Molecular Formula | C12H10S2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 1-benzothiophene;thiophene |
| SMILES | c1ccc2sccc2c1.c1ccsc1 |
| InChI | InChI=1S/C8H6S.C4H4S/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1/h1-6H;1-4H |
| InChIKey | AVJPROTYKYNVCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzothiophene;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;thiophene?
The IUPAC name of 1-benzothiophene;thiophene (CID 67877268) is 1-benzothiophene;thiophene.
What is the SMILES notation for 1-benzothiophene;thiophene?
The canonical SMILES for 1-benzothiophene;thiophene is c1ccc2sccc2c1.c1ccsc1.
What is the InChIKey of 1-benzothiophene;thiophene?
The InChIKey is AVJPROTYKYNVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C4H4S/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1/h1-6H;1-4H.
What are the key properties of 1-benzothiophene;thiophene?
1-benzothiophene;thiophene has a molecular weight of 218.35 g/mol, XLogP of 4.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;thiophene is sourced from PubChem (CID 67877268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).