About dibenzothiophene
dibenzothiophene (PubChem CID 3023) has the molecular formula C12H8S
and a molecular weight of 184.26 g/mol. Its IUPAC name is dibenzothiophene.
Molecular Properties
| Compound Name | dibenzothiophene |
| PubChem CID | 3023 |
| Molecular Formula | C12H8S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | dibenzothiophene |
| SMILES | c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H |
| InChIKey | IYYZUPMFVPLQIF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene?
The IUPAC name of dibenzothiophene (CID 3023) is dibenzothiophene.
What is the SMILES notation for dibenzothiophene?
The canonical SMILES for dibenzothiophene is c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene?
The InChIKey is IYYZUPMFVPLQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H.
What are the key properties of dibenzothiophene?
dibenzothiophene has a molecular weight of 184.26 g/mol, XLogP of 4.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene is sourced from PubChem (CID 3023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).