About 1-benzothiophene;gadolinium;hydrochloride
1-benzothiophene;gadolinium;hydrochloride (PubChem CID 174939578) has the molecular formula C8H7ClGdS
and a molecular weight of 327.91 g/mol. Its IUPAC name is 1-benzothiophene;gadolinium;hydrochloride.
Molecular Properties
| Compound Name | 1-benzothiophene;gadolinium;hydrochloride |
| PubChem CID | 174939578 |
| Molecular Formula | C8H7ClGdS |
| Molecular Weight | 327.91 g/mol |
| Exact Mass | 327.92 |
| IUPAC Name | 1-benzothiophene;gadolinium;hydrochloride |
| SMILES | Cl.[Gd].c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.ClH.Gd/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6H;1H; |
| InChIKey | GUGHNAZITQFYMS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzothiophene;gadolinium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;gadolinium;hydrochloride?
The IUPAC name of 1-benzothiophene;gadolinium;hydrochloride (CID 174939578) is 1-benzothiophene;gadolinium;hydrochloride.
What is the SMILES notation for 1-benzothiophene;gadolinium;hydrochloride?
The canonical SMILES for 1-benzothiophene;gadolinium;hydrochloride is Cl.[Gd].c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;gadolinium;hydrochloride?
The InChIKey is GUGHNAZITQFYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.ClH.Gd/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6H;1H;.
What are the key properties of 1-benzothiophene;gadolinium;hydrochloride?
1-benzothiophene;gadolinium;hydrochloride has a molecular weight of 327.91 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;gadolinium;hydrochloride is sourced from PubChem (CID 174939578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).