About 1-benzothiophene;1-benzothiophen-2-ylboronic acid
1-benzothiophene;1-benzothiophen-2-ylboronic acid (PubChem CID 159856249) has the molecular formula C16H13BO2S2
and a molecular weight of 312.22 g/mol. Its IUPAC name is 1-benzothiophene;1-benzothiophen-2-ylboronic acid.
Molecular Properties
| Compound Name | 1-benzothiophene;1-benzothiophen-2-ylboronic acid |
| PubChem CID | 159856249 |
| Molecular Formula | C16H13BO2S2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-benzothiophene;1-benzothiophen-2-ylboronic acid |
| SMILES | OB(O)c1cc2ccccc2s1.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H7BO2S.C8H6S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8;1-2-4-8-7(3-1)5-6-9-8/h1-5,10-11H;1-6H |
| InChIKey | NQOKABSPFJCYEI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene;1-benzothiophen-2-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;1-benzothiophen-2-ylboronic acid?
The IUPAC name of 1-benzothiophene;1-benzothiophen-2-ylboronic acid (CID 159856249) is 1-benzothiophene;1-benzothiophen-2-ylboronic acid.
What is the SMILES notation for 1-benzothiophene;1-benzothiophen-2-ylboronic acid?
The canonical SMILES for 1-benzothiophene;1-benzothiophen-2-ylboronic acid is OB(O)c1cc2ccccc2s1.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;1-benzothiophen-2-ylboronic acid?
The InChIKey is NQOKABSPFJCYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BO2S.C8H6S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8;1-2-4-8-7(3-1)5-6-9-8/h1-5,10-11H;1-6H.
What are the key properties of 1-benzothiophene;1-benzothiophen-2-ylboronic acid?
1-benzothiophene;1-benzothiophen-2-ylboronic acid has a molecular weight of 312.22 g/mol, XLogP of 3.48, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;1-benzothiophen-2-ylboronic acid is sourced from PubChem (CID 159856249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).