About 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid
1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid (PubChem CID 175206367) has the molecular formula C13H12O4S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid |
| PubChem CID | 175206367 |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid |
| SMILES | COC(=O)C=CC(=O)O.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.C5H6O4/c1-2-4-8-7(3-1)5-6-9-8;1-9-5(8)3-2-4(6)7/h1-6H;2-3H,1H3,(H,6,7) |
| InChIKey | QHVQPWQUNFTSQK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid?
The IUPAC name of 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid (CID 175206367) is 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid.
What is the SMILES notation for 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid?
The canonical SMILES for 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid is COC(=O)C=CC(=O)O.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid?
The InChIKey is QHVQPWQUNFTSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C5H6O4/c1-2-4-8-7(3-1)5-6-9-8;1-9-5(8)3-2-4(6)7/h1-6H;2-3H,1H3,(H,6,7).
What are the key properties of 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid?
1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid has a molecular weight of 264.30 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;4-methoxy-4-oxobut-2-enoic acid is sourced from PubChem (CID 175206367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).