About thieno[2,3-g][2,1]benzoxazole
thieno[2,3-g][2,1]benzoxazole (PubChem CID 59692784) has the molecular formula C9H5NOS
and a molecular weight of 175.21 g/mol. Its IUPAC name is thieno[2,3-g][2,1]benzoxazole.
Molecular Properties
| Compound Name | thieno[2,3-g][2,1]benzoxazole |
| PubChem CID | 59692784 |
| Molecular Formula | C9H5NOS |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | thieno[2,3-g][2,1]benzoxazole |
| SMILES | c1cc2c(ccc3conc32)s1 |
| InChI | InChI=1S/C9H5NOS/c1-2-8-7(3-4-12-8)9-6(1)5-11-10-9/h1-5H |
| InChIKey | WEYPCTJEHIVDCC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[2,3-g][2,1]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-g][2,1]benzoxazole?
The IUPAC name of thieno[2,3-g][2,1]benzoxazole (CID 59692784) is thieno[2,3-g][2,1]benzoxazole.
What is the SMILES notation for thieno[2,3-g][2,1]benzoxazole?
The canonical SMILES for thieno[2,3-g][2,1]benzoxazole is c1cc2c(ccc3conc32)s1.
What is the InChIKey of thieno[2,3-g][2,1]benzoxazole?
The InChIKey is WEYPCTJEHIVDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NOS/c1-2-8-7(3-4-12-8)9-6(1)5-11-10-9/h1-5H.
What are the key properties of thieno[2,3-g][2,1]benzoxazole?
thieno[2,3-g][2,1]benzoxazole has a molecular weight of 175.21 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-g][2,1]benzoxazole is sourced from PubChem (CID 59692784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).