C9H5NOS — CID 59692784
thieno[2,3-g][2,1]benzoxazole (PubChem CID 59692784) has the molecular formula C9H5NOS and a molecular weight of 175.21 g/mol. Its IUPAC name is thieno[2,3-g][2,1]benzoxazole.
| Compound Name | thieno[2,3-g][2,1]benzoxazole |
|---|---|
| PubChem CID | 59692784 |
| Molecular Formula | C9H5NOS |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | thieno[2,3-g][2,1]benzoxazole |
| SMILES | c1cc2c(ccc3conc32)s1 |
| InChI | InChI=1S/C9H5NOS/c1-2-8-7(3-4-12-8)9-6(1)5-11-10-9/h1-5H |
| InChIKey | WEYPCTJEHIVDCC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |