C17H10O2S — CID 134693380
naphtho[2,3-e][1]benzothiole-2-carboxylic acid (PubChem CID 134693380) has the molecular formula C17H10O2S and a molecular weight of 278.33 g/mol. Its IUPAC name is naphtho[2,3-e][1]benzothiole-2-carboxylic acid.
| Compound Name | naphtho[2,3-e][1]benzothiole-2-carboxylic acid |
|---|---|
| PubChem CID | 134693380 |
| Molecular Formula | C17H10O2S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | naphtho[2,3-e][1]benzothiole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(ccc3cc4ccccc4cc32)s1 |
| InChI | InChI=1S/C17H10O2S/c18-17(19)16-9-14-13-8-11-4-2-1-3-10(11)7-12(13)5-6-15(14)20-16/h1-9H,(H,18,19) |
| InChIKey | CHSFISBIOPCCDL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|