About benzamide;1-benzothiophene-2-carboxylic acid
benzamide;1-benzothiophene-2-carboxylic acid (PubChem CID 158859851) has the molecular formula C16H13NO3S
and a molecular weight of 299.35 g/mol. Its IUPAC name is benzamide;1-benzothiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | benzamide;1-benzothiophene-2-carboxylic acid |
| PubChem CID | 158859851 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | benzamide;1-benzothiophene-2-carboxylic acid |
| SMILES | NC(=O)c1ccccc1.O=C(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C9H6O2S.C7H7NO/c10-9(11)8-5-6-3-1-2-4-7(6)12-8;8-7(9)6-4-2-1-3-5-6/h1-5H,(H,10,11);1-5H,(H2,8,9) |
| InChIKey | JANFVBWZPPHVJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzamide;1-benzothiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;1-benzothiophene-2-carboxylic acid?
The IUPAC name of benzamide;1-benzothiophene-2-carboxylic acid (CID 158859851) is benzamide;1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for benzamide;1-benzothiophene-2-carboxylic acid?
The canonical SMILES for benzamide;1-benzothiophene-2-carboxylic acid is NC(=O)c1ccccc1.O=C(O)c1cc2ccccc2s1.
What is the InChIKey of benzamide;1-benzothiophene-2-carboxylic acid?
The InChIKey is JANFVBWZPPHVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2S.C7H7NO/c10-9(11)8-5-6-3-1-2-4-7(6)12-8;8-7(9)6-4-2-1-3-5-6/h1-5H,(H,10,11);1-5H,(H2,8,9).
What are the key properties of benzamide;1-benzothiophene-2-carboxylic acid?
benzamide;1-benzothiophene-2-carboxylic acid has a molecular weight of 299.35 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 158859851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).