C13H18OS2 — CID 115830002
5-methyl-1-thieno[3,2-b]thiophen-5-ylhexan-1-ol (PubChem CID 115830002) has the molecular formula C13H18OS2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 5-methyl-1-thieno[3,2-b]thiophen-5-ylhexan-1-ol.
| Compound Name | 5-methyl-1-thieno[3,2-b]thiophen-5-ylhexan-1-ol |
|---|---|
| PubChem CID | 115830002 |
| Molecular Formula | C13H18OS2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-methyl-1-thieno[3,2-b]thiophen-5-ylhexan-1-ol |
| SMILES | CC(C)CCCC(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H18OS2/c1-9(2)4-3-5-10(14)12-8-13-11(16-12)6-7-15-13/h6-10,14H,3-5H2,1-2H3 |
| InChIKey | FRFWKURVKQUUMR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |