C11H11F3OS2 — CID 115828390
5,5,5-trifluoro-1-thieno[3,2-b]thiophen-5-ylpentan-1-ol (PubChem CID 115828390) has the molecular formula C11H11F3OS2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-thieno[3,2-b]thiophen-5-ylpentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-thieno[3,2-b]thiophen-5-ylpentan-1-ol |
|---|---|
| PubChem CID | 115828390 |
| Molecular Formula | C11H11F3OS2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 5,5,5-trifluoro-1-thieno[3,2-b]thiophen-5-ylpentan-1-ol |
| SMILES | OC(CCCC(F)(F)F)c1cc2sccc2s1 |
| InChI | InChI=1S/C11H11F3OS2/c12-11(13,14)4-1-2-7(15)9-6-10-8(17-9)3-5-16-10/h3,5-7,15H,1-2,4H2 |
| InChIKey | RJRGEPUFJLSVIG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |