C10H13F3OS — CID 115515429
5,5,5-trifluoro-1-(5-methylthiophen-2-yl)pentan-1-ol (PubChem CID 115515429) has the molecular formula C10H13F3OS and a molecular weight of 238.27 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(5-methylthiophen-2-yl)pentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-(5-methylthiophen-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 115515429 |
| Molecular Formula | C10H13F3OS |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5,5,5-trifluoro-1-(5-methylthiophen-2-yl)pentan-1-ol |
| SMILES | Cc1ccc(C(O)CCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H13F3OS/c1-7-4-5-9(15-7)8(14)3-2-6-10(11,12)13/h4-5,8,14H,2-3,6H2,1H3 |
| InChIKey | GLXQHBZMJGABDD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |