C10H13F3OS — CID 115808765
1-(4,5-dimethylthiophen-2-yl)-4,4,4-trifluorobutan-1-ol (PubChem CID 115808765) has the molecular formula C10H13F3OS and a molecular weight of 238.27 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 115808765 |
| Molecular Formula | C10H13F3OS |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)-4,4,4-trifluorobutan-1-ol |
| SMILES | Cc1cc(C(O)CCC(F)(F)F)sc1C |
| InChI | InChI=1S/C10H13F3OS/c1-6-5-9(15-7(6)2)8(14)3-4-10(11,12)13/h5,8,14H,3-4H2,1-2H3 |
| InChIKey | MJWIFSHTIRSSRB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |