C9H9Br2F3S — CID 79991805
2-bromo-5-(1-bromo-4,4,4-trifluorobutyl)-3-methylthiophene (PubChem CID 79991805) has the molecular formula C9H9Br2F3S and a molecular weight of 366.04 g/mol. Its IUPAC name is 2-bromo-5-(1-bromo-4,4,4-trifluorobutyl)-3-methylthiophene.
| Compound Name | 2-bromo-5-(1-bromo-4,4,4-trifluorobutyl)-3-methylthiophene |
|---|---|
| PubChem CID | 79991805 |
| Molecular Formula | C9H9Br2F3S |
| Molecular Weight | 366.04 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | 2-bromo-5-(1-bromo-4,4,4-trifluorobutyl)-3-methylthiophene |
| SMILES | Cc1cc(C(Br)CCC(F)(F)F)sc1Br |
| InChI | InChI=1S/C9H9Br2F3S/c1-5-4-7(15-8(5)11)6(10)2-3-9(12,13)14/h4,6H,2-3H2,1H3 |
| InChIKey | LUQQMHKMKNVYCH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.04 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|