C10H12BrF4NS — CID 79991335
1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 79991335) has the molecular formula C10H12BrF4NS and a molecular weight of 334.18 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 79991335 |
| Molecular Formula | C10H12BrF4NS |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCNC(c1cc(C)c(Br)s1)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H12BrF4NS/c1-3-16-7(10(14,15)9(12)13)6-4-5(2)8(11)17-6/h4,7,9,16H,3H2,1-2H3 |
| InChIKey | KQSZVGYNFOFLKM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|