C14H13Br2F2NS — CID 79981661
N-[(4-bromo-2,5-difluorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 79981661) has the molecular formula C14H13Br2F2NS and a molecular weight of 425.14 g/mol. Its IUPAC name is N-[(4-bromo-2,5-difluorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-2,5-difluorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79981661 |
| Molecular Formula | C14H13Br2F2NS |
| Molecular Weight | 425.14 g/mol |
| Exact Mass | 422.91 |
| IUPAC Name | N-[(4-bromo-2,5-difluorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(C)c(Br)s1)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H13Br2F2NS/c1-3-19-13(12-4-7(2)14(16)20-12)8-5-11(18)9(15)6-10(8)17/h4-6,13,19H,3H2,1-2H3 |
| InChIKey | XFBVGDDGBKXTPM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.14 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|