C12H13Br2NOS — CID 79992090
N-[(5-bromofuran-2-yl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 79992090) has the molecular formula C12H13Br2NOS and a molecular weight of 379.12 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromofuran-2-yl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79992090 |
| Molecular Formula | C12H13Br2NOS |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | N-[(5-bromofuran-2-yl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)o1)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C12H13Br2NOS/c1-3-15-11(8-4-5-10(13)16-8)9-6-7(2)12(14)17-9/h4-6,11,15H,3H2,1-2H3 |
| InChIKey | DQANRFCYMIPOBH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |