C9H9Cl2F4NS — CID 79660890
1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 79660890) has the molecular formula C9H9Cl2F4NS and a molecular weight of 310.14 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 79660890 |
| Molecular Formula | C9H9Cl2F4NS |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCNC(c1cc(Cl)sc1Cl)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H9Cl2F4NS/c1-2-16-6(9(14,15)8(12)13)4-3-5(10)17-7(4)11/h3,6,8,16H,2H2,1H3 |
| InChIKey | QJBODHJJXXJDDN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|