C9H12BrF3N2S — CID 105313942
[1-(5-bromo-4-methylthiophen-2-yl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 105313942) has the molecular formula C9H12BrF3N2S and a molecular weight of 317.17 g/mol. Its IUPAC name is [1-(5-bromo-4-methylthiophen-2-yl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(5-bromo-4-methylthiophen-2-yl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 105313942 |
| Molecular Formula | C9H12BrF3N2S |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | [1-(5-bromo-4-methylthiophen-2-yl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | Cc1cc(C(CCC(F)(F)F)NN)sc1Br |
| InChI | InChI=1S/C9H12BrF3N2S/c1-5-4-7(16-8(5)10)6(15-14)2-3-9(11,12)13/h4,6,15H,2-3,14H2,1H3 |
| InChIKey | KKTBXTKPHUJFBU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|