C14H24BrNOS — CID 103031765
1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine (PubChem CID 103031765) has the molecular formula C14H24BrNOS and a molecular weight of 334.32 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 103031765 |
| Molecular Formula | C14H24BrNOS |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine |
| SMILES | CCNC(CCC(C)(C)OC)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C14H24BrNOS/c1-6-16-11(7-8-14(3,4)17-5)12-9-10(2)13(15)18-12/h9,11,16H,6-8H2,1-5H3 |
| InChIKey | PNLLEUXYTKJJID-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |