C13H22BrNO2 — CID 103031302
1-(5-bromofuran-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine (PubChem CID 103031302) has the molecular formula C13H22BrNO2 and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine.
| Compound Name | 1-(5-bromofuran-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 103031302 |
| Molecular Formula | C13H22BrNO2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-N-ethyl-4-methoxy-4-methylpentan-1-amine |
| SMILES | CCNC(CCC(C)(C)OC)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H22BrNO2/c1-5-15-10(8-9-13(2,3)16-4)11-6-7-12(14)17-11/h6-7,10,15H,5,8-9H2,1-4H3 |
| InChIKey | FBYBTQMEPVUVQS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |