C15H23BrClNO — CID 107995834
1-(2-bromo-4-chlorophenyl)-N-ethyl-4-methoxy-4-methylpentan-1-amine (PubChem CID 107995834) has the molecular formula C15H23BrClNO and a molecular weight of 348.71 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-N-ethyl-4-methoxy-4-methylpentan-1-amine.
| Compound Name | 1-(2-bromo-4-chlorophenyl)-N-ethyl-4-methoxy-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 107995834 |
| Molecular Formula | C15H23BrClNO |
| Molecular Weight | 348.71 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-N-ethyl-4-methoxy-4-methylpentan-1-amine |
| SMILES | CCNC(CCC(C)(C)OC)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C15H23BrClNO/c1-5-18-14(8-9-15(2,3)19-4)12-7-6-11(17)10-13(12)16/h6-7,10,14,18H,5,8-9H2,1-4H3 |
| InChIKey | KJDBPNCQHMXESE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |