C12H21BrN2S — CID 105300069
[1-(5-bromo-4-methylthiophen-2-yl)-4,4-dimethylpentyl]hydrazine (PubChem CID 105300069) has the molecular formula C12H21BrN2S and a molecular weight of 305.29 g/mol. Its IUPAC name is [1-(5-bromo-4-methylthiophen-2-yl)-4,4-dimethylpentyl]hydrazine.
| Compound Name | [1-(5-bromo-4-methylthiophen-2-yl)-4,4-dimethylpentyl]hydrazine |
|---|---|
| PubChem CID | 105300069 |
| Molecular Formula | C12H21BrN2S |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [1-(5-bromo-4-methylthiophen-2-yl)-4,4-dimethylpentyl]hydrazine |
| SMILES | Cc1cc(C(CCC(C)(C)C)NN)sc1Br |
| InChI | InChI=1S/C12H21BrN2S/c1-8-7-10(16-11(8)13)9(15-14)5-6-12(2,3)4/h7,9,15H,5-6,14H2,1-4H3 |
| InChIKey | LOHCEDCZHVKOGK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|