C9H14BrNS — CID 79991964
1-(5-bromo-4-methylthiophen-2-yl)-N-methylpropan-1-amine (PubChem CID 79991964) has the molecular formula C9H14BrNS and a molecular weight of 248.19 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-N-methylpropan-1-amine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79991964 |
| Molecular Formula | C9H14BrNS |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C9H14BrNS/c1-4-7(11-3)8-5-6(2)9(10)12-8/h5,7,11H,4H2,1-3H3 |
| InChIKey | CUIGWYXZXTVFDM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |