C14H20BrN3S — CID 105002532
1-(5-bromo-4-methylthiophen-2-yl)-2-(2-ethyl-5-methylpyrazol-3-yl)-N-methylethanamine (PubChem CID 105002532) has the molecular formula C14H20BrN3S and a molecular weight of 342.31 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-2-(2-ethyl-5-methylpyrazol-3-yl)-N-methylethanamine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-2-(2-ethyl-5-methylpyrazol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105002532 |
| Molecular Formula | C14H20BrN3S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-2-(2-ethyl-5-methylpyrazol-3-yl)-N-methylethanamine |
| SMILES | CCn1nc(C)cc1CC(NC)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C14H20BrN3S/c1-5-18-11(7-10(3)17-18)8-12(16-4)13-6-9(2)14(15)19-13/h6-7,12,16H,5,8H2,1-4H3 |
| InChIKey | DCTQGRQGRMCXSR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |