C9H15BrN2O2S2 — CID 114985173
[1-(5-bromo-4-methylthiophen-2-yl)-3-methylsulfonylpropyl]hydrazine (PubChem CID 114985173) has the molecular formula C9H15BrN2O2S2 and a molecular weight of 327.27 g/mol. Its IUPAC name is [1-(5-bromo-4-methylthiophen-2-yl)-3-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(5-bromo-4-methylthiophen-2-yl)-3-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 114985173 |
| Molecular Formula | C9H15BrN2O2S2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | [1-(5-bromo-4-methylthiophen-2-yl)-3-methylsulfonylpropyl]hydrazine |
| SMILES | Cc1cc(C(CCS(C)(=O)=O)NN)sc1Br |
| InChI | InChI=1S/C9H15BrN2O2S2/c1-6-5-8(15-9(6)10)7(12-11)3-4-16(2,13)14/h5,7,12H,3-4,11H2,1-2H3 |
| InChIKey | KHZCAUOAIQAUEC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|