C9H14BrN3O2S — CID 114984828
[1-(5-bromo-3-pyridinyl)-3-methylsulfonylpropyl]hydrazine (PubChem CID 114984828) has the molecular formula C9H14BrN3O2S and a molecular weight of 308.20 g/mol. Its IUPAC name is [1-(5-bromo-3-pyridinyl)-3-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(5-bromo-3-pyridinyl)-3-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 114984828 |
| Molecular Formula | C9H14BrN3O2S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | [1-(5-bromo-3-pyridinyl)-3-methylsulfonylpropyl]hydrazine |
| SMILES | CS(=O)(=O)CCC(NN)c1cncc(Br)c1 |
| InChI | InChI=1S/C9H14BrN3O2S/c1-16(14,15)3-2-9(13-11)7-4-8(10)6-12-5-7/h4-6,9,13H,2-3,11H2,1H3 |
| InChIKey | VWLMZFLEHFLYCN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|