C14H22OS — CID 107012353
1-(4,5-dimethylthiophen-2-yl)oct-7-en-1-ol (PubChem CID 107012353) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)oct-7-en-1-ol.
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)oct-7-en-1-ol |
|---|---|
| PubChem CID | 107012353 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)oct-7-en-1-ol |
| SMILES | C=CCCCCCC(O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C14H22OS/c1-4-5-6-7-8-9-13(15)14-10-11(2)12(3)16-14/h4,10,13,15H,1,5-9H2,2-3H3 |
| InChIKey | AACUIPPDLXKAKG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|