C14H20O — CID 115804443
1-(3,4-dimethylphenyl)hex-5-en-1-ol (PubChem CID 115804443) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)hex-5-en-1-ol.
| Compound Name | 1-(3,4-dimethylphenyl)hex-5-en-1-ol |
|---|---|
| PubChem CID | 115804443 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)hex-5-en-1-ol |
| SMILES | C=CCCCC(O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H20O/c1-4-5-6-7-14(15)13-9-8-11(2)12(3)10-13/h4,8-10,14-15H,1,5-7H2,2-3H3 |
| InChIKey | JJCNSCKWJWAMLJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|