C10H13ClO — CID 83000699
(1R)-2-chloro-1-(3,4-dimethylphenyl)ethanol (PubChem CID 83000699) has the molecular formula C10H13ClO and a molecular weight of 184.67 g/mol. Its IUPAC name is (1R)-2-chloro-1-(3,4-dimethylphenyl)ethanol.
| Compound Name | (1R)-2-chloro-1-(3,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 83000699 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1R)-2-chloro-1-(3,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc([C@@H](O)CCl)cc1C |
| InChI | InChI=1S/C10H13ClO/c1-7-3-4-9(5-8(7)2)10(12)6-11/h3-5,10,12H,6H2,1-2H3/t10-/m0/s1 |
| InChIKey | ONKTYQKESNPTOB-JTQLQIEISA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|